C16H21N3O2 — CID 141083277
ethyl 2-[(6-cyanoiminocyclohexa-2,4-dien-1-yl)-(3-methylbut-2-enyl)amino]acetate (PubChem CID 141083277) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is ethyl 2-[(6-cyanoiminocyclohexa-2,4-dien-1-yl)-(3-methylbut-2-enyl)amino]acetate.
| Compound Name | ethyl 2-[(6-cyanoiminocyclohexa-2,4-dien-1-yl)-(3-methylbut-2-enyl)amino]acetate |
|---|---|
| PubChem CID | 141083277 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | ethyl 2-[(6-cyanoiminocyclohexa-2,4-dien-1-yl)-(3-methylbut-2-enyl)amino]acetate |
| SMILES | CCOC(=O)CN(CC=C(C)C)C1C=CC=C/C1=N\C#N |
| InChI | InChI=1S/C16H21N3O2/c1-4-21-16(20)11-19(10-9-13(2)3)15-8-6-5-7-14(15)18-12-17/h5-9,15H,4,10-11H2,1-3H3/b18-14+ |
| InChIKey | RSRSWQLYPONMSK-NBVRZTHBSA-N |
| XLogP | 2.23 |
| TPSA | 65.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|