C21H26N2O3 — CID 152650820
ethyl 2-[(6-phenylmethoxyiminocyclohexa-2,4-dien-1-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 152650820) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is ethyl 2-[(6-phenylmethoxyiminocyclohexa-2,4-dien-1-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | ethyl 2-[(6-phenylmethoxyiminocyclohexa-2,4-dien-1-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 152650820 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | ethyl 2-[(6-phenylmethoxyiminocyclohexa-2,4-dien-1-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC1CC1C=CC=CC1=NOCc1ccccc1 |
| InChI | InChI=1S/C21H26N2O3/c1-2-25-21(24)23-14-8-12-19(23)15-18-11-6-7-13-20(18)22-26-16-17-9-4-3-5-10-17/h3-7,9-11,13,18-19H,2,8,12,14-16H2,1H3 |
| InChIKey | ZHNBWLCLTKLMKO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|