C13H16O — CID 101029310
1-ethyl-4-methoxy-1,4-dihydronaphthalene (PubChem CID 101029310) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-ethyl-4-methoxy-1,4-dihydronaphthalene.
| Compound Name | 1-ethyl-4-methoxy-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 101029310 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 1-ethyl-4-methoxy-1,4-dihydronaphthalene |
| SMILES | CCC1C=CC(OC)c2ccccc21 |
| InChI | InChI=1S/C13H16O/c1-3-10-8-9-13(14-2)12-7-5-4-6-11(10)12/h4-10,13H,3H2,1-2H3 |
| InChIKey | IZLRECYTEJFUMQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|