About 2-[(2R)-1-oxo-1-phenyl-1λ5-phospholan-2-yl]ethanol
2-[(2R)-1-oxo-1-phenyl-1λ5-phospholan-2-yl]ethanol (PubChem CID 59127796) has the molecular formula C12H17O2P
and a molecular weight of 224.24 g/mol. Its IUPAC name is 2-[(2R)-1-oxo-1-phenyl-1λ5-phospholan-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[(2R)-1-oxo-1-phenyl-1λ5-phospholan-2-yl]ethanol |
| PubChem CID | 59127796 |
| Molecular Formula | C12H17O2P |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-[(2R)-1-oxo-1-phenyl-1λ5-phospholan-2-yl]ethanol |
| SMILES | O=P1(c2ccccc2)CCC[C@@H]1CCO |
| InChI | InChI=1S/C12H17O2P/c13-9-8-12-7-4-10-15(12,14)11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10H2/t12-,15?/m1/s1 |
| InChIKey | NQVRTTUTSTZTHQ-KEKZHRQWSA-N |
| XLogP | 2.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2R)-1-oxo-1-phenyl-1λ5-phospholan-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-1-oxo-1-phenyl-1λ5-phospholan-2-yl]ethanol?
The IUPAC name of 2-[(2R)-1-oxo-1-phenyl-1λ5-phospholan-2-yl]ethanol (CID 59127796) is 2-[(2R)-1-oxo-1-phenyl-1λ5-phospholan-2-yl]ethanol.
What is the SMILES notation for 2-[(2R)-1-oxo-1-phenyl-1λ5-phospholan-2-yl]ethanol?
The canonical SMILES for 2-[(2R)-1-oxo-1-phenyl-1λ5-phospholan-2-yl]ethanol is O=P1(c2ccccc2)CCC[C@@H]1CCO.
What is the InChIKey of 2-[(2R)-1-oxo-1-phenyl-1λ5-phospholan-2-yl]ethanol?
The InChIKey is NQVRTTUTSTZTHQ-KEKZHRQWSA-N. The full InChI is InChI=1S/C12H17O2P/c13-9-8-12-7-4-10-15(12,14)11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10H2/t12-,15?/m1/s1.
What are the key properties of 2-[(2R)-1-oxo-1-phenyl-1λ5-phospholan-2-yl]ethanol?
2-[(2R)-1-oxo-1-phenyl-1λ5-phospholan-2-yl]ethanol has a molecular weight of 224.24 g/mol, XLogP of 2.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-1-oxo-1-phenyl-1λ5-phospholan-2-yl]ethanol is sourced from PubChem (CID 59127796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).