C16H16OP2 — CID 11129874
2,6-diphenyl-2λ5,6-diphosphabicyclo[3.1.0]hexane 2-oxide (PubChem CID 11129874) has the molecular formula C16H16OP2 and a molecular weight of 286.25 g/mol. Its IUPAC name is 2,6-diphenyl-2λ5,6-diphosphabicyclo[3.1.0]hexane 2-oxide.
| Compound Name | 2,6-diphenyl-2λ5,6-diphosphabicyclo[3.1.0]hexane 2-oxide |
|---|---|
| PubChem CID | 11129874 |
| Molecular Formula | C16H16OP2 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2,6-diphenyl-2λ5,6-diphosphabicyclo[3.1.0]hexane 2-oxide |
| SMILES | O=P1(c2ccccc2)CCC2C1P2c1ccccc1 |
| InChI | InChI=1S/C16H16OP2/c17-19(14-9-5-2-6-10-14)12-11-15-16(19)18(15)13-7-3-1-4-8-13/h1-10,15-16H,11-12H2 |
| InChIKey | LGTFJYWCOSIWSM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|