C15H19OP — CID 13103983
1-phenyl-2,3,4a,5,6,7,8,8a-octahydrophosphinolin-4-one (PubChem CID 13103983) has the molecular formula C15H19OP and a molecular weight of 246.29 g/mol. Its IUPAC name is 1-phenyl-2,3,4a,5,6,7,8,8a-octahydrophosphinolin-4-one.
| Compound Name | 1-phenyl-2,3,4a,5,6,7,8,8a-octahydrophosphinolin-4-one |
|---|---|
| PubChem CID | 13103983 |
| Molecular Formula | C15H19OP |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1-phenyl-2,3,4a,5,6,7,8,8a-octahydrophosphinolin-4-one |
| SMILES | O=C1CCP(c2ccccc2)C2CCCCC12 |
| InChI | InChI=1S/C15H19OP/c16-14-10-11-17(12-6-2-1-3-7-12)15-9-5-4-8-13(14)15/h1-3,6-7,13,15H,4-5,8-11H2 |
| InChIKey | GBARFHJMHOVBST-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|