C15H19NO3S — CID 555825
1-(benzenesulfonyl)-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one (PubChem CID 555825) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one.
| Compound Name | 1-(benzenesulfonyl)-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one |
|---|---|
| PubChem CID | 555825 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 1-(benzenesulfonyl)-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one |
| SMILES | O=C1CCN(S(=O)(=O)c2ccccc2)C2CCCCC12 |
| InChI | InChI=1S/C15H19NO3S/c17-15-10-11-16(14-9-5-4-8-13(14)15)20(18,19)12-6-2-1-3-7-12/h1-3,6-7,13-14H,4-5,8-11H2 |
| InChIKey | XTGOMZSUKFHORZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |