C16H18F3NO3S — CID 136531002
2-[1-(3,4,5-trifluorophenyl)sulfonylpyrrolidin-2-yl]cyclohexan-1-one (PubChem CID 136531002) has the molecular formula C16H18F3NO3S and a molecular weight of 361.39 g/mol. Its IUPAC name is 2-[1-(3,4,5-trifluorophenyl)sulfonylpyrrolidin-2-yl]cyclohexan-1-one.
| Compound Name | 2-[1-(3,4,5-trifluorophenyl)sulfonylpyrrolidin-2-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 136531002 |
| Molecular Formula | C16H18F3NO3S |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-[1-(3,4,5-trifluorophenyl)sulfonylpyrrolidin-2-yl]cyclohexan-1-one |
| SMILES | O=C1CCCCC1C1CCCN1S(=O)(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C16H18F3NO3S/c17-12-8-10(9-13(18)16(12)19)24(22,23)20-7-3-5-14(20)11-4-1-2-6-15(11)21/h8-9,11,14H,1-7H2 |
| InChIKey | PMIOSMLWTJCDMF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|