C15H21NO3S2 — CID 79539732
2-[1-(5-methylthiophen-2-yl)sulfonylpyrrolidin-2-yl]cyclohexan-1-one (PubChem CID 79539732) has the molecular formula C15H21NO3S2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 2-[1-(5-methylthiophen-2-yl)sulfonylpyrrolidin-2-yl]cyclohexan-1-one.
| Compound Name | 2-[1-(5-methylthiophen-2-yl)sulfonylpyrrolidin-2-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 79539732 |
| Molecular Formula | C15H21NO3S2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-[1-(5-methylthiophen-2-yl)sulfonylpyrrolidin-2-yl]cyclohexan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC2C2CCCCC2=O)s1 |
| InChI | InChI=1S/C15H21NO3S2/c1-11-8-9-15(20-11)21(18,19)16-10-4-6-13(16)12-5-2-3-7-14(12)17/h8-9,12-13H,2-7,10H2,1H3 |
| InChIKey | MVDJWDJVQUUJDV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |