C13H19N3O3S — CID 104709969
2-[1-(2-methylpyrazol-3-yl)sulfonylpyrrolidin-2-yl]cyclopentan-1-one (PubChem CID 104709969) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-[1-(2-methylpyrazol-3-yl)sulfonylpyrrolidin-2-yl]cyclopentan-1-one.
| Compound Name | 2-[1-(2-methylpyrazol-3-yl)sulfonylpyrrolidin-2-yl]cyclopentan-1-one |
|---|---|
| PubChem CID | 104709969 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-[1-(2-methylpyrazol-3-yl)sulfonylpyrrolidin-2-yl]cyclopentan-1-one |
| SMILES | Cn1nccc1S(=O)(=O)N1CCCC1C1CCCC1=O |
| InChI | InChI=1S/C13H19N3O3S/c1-15-13(7-8-14-15)20(18,19)16-9-3-5-11(16)10-4-2-6-12(10)17/h7-8,10-11H,2-6,9H2,1H3 |
| InChIKey | BLXXYYFYURFDBN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |