C16H25N3O — CID 103002715
2-[1-[2-(2-methylpyrazol-3-yl)ethyl]piperidin-2-yl]cyclopentan-1-one (PubChem CID 103002715) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 2-[1-[2-(2-methylpyrazol-3-yl)ethyl]piperidin-2-yl]cyclopentan-1-one.
| Compound Name | 2-[1-[2-(2-methylpyrazol-3-yl)ethyl]piperidin-2-yl]cyclopentan-1-one |
|---|---|
| PubChem CID | 103002715 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 2-[1-[2-(2-methylpyrazol-3-yl)ethyl]piperidin-2-yl]cyclopentan-1-one |
| SMILES | Cn1nccc1CCN1CCCCC1C1CCCC1=O |
| InChI | InChI=1S/C16H25N3O/c1-18-13(8-10-17-18)9-12-19-11-3-2-6-15(19)14-5-4-7-16(14)20/h8,10,14-15H,2-7,9,11-12H2,1H3 |
| InChIKey | PEZQJCSZUFLCAU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |