C13H22BrN3 — CID 103015231
2-(2-bromoethyl)-1-[2-(2-methylpyrazol-3-yl)ethyl]piperidine (PubChem CID 103015231) has the molecular formula C13H22BrN3 and a molecular weight of 300.24 g/mol. Its IUPAC name is 2-(2-bromoethyl)-1-[2-(2-methylpyrazol-3-yl)ethyl]piperidine.
| Compound Name | 2-(2-bromoethyl)-1-[2-(2-methylpyrazol-3-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 103015231 |
| Molecular Formula | C13H22BrN3 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-(2-bromoethyl)-1-[2-(2-methylpyrazol-3-yl)ethyl]piperidine |
| SMILES | Cn1nccc1CCN1CCCCC1CCBr |
| InChI | InChI=1S/C13H22BrN3/c1-16-12(6-9-15-16)7-11-17-10-3-2-4-13(17)5-8-14/h6,9,13H,2-5,7-8,10-11H2,1H3 |
| InChIKey | FVENCSKNPAXJBP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|