C11H18ClN3 — CID 103015106
4-chloro-1-[2-(2-methylpyrazol-3-yl)ethyl]piperidine (PubChem CID 103015106) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is 4-chloro-1-[2-(2-methylpyrazol-3-yl)ethyl]piperidine.
| Compound Name | 4-chloro-1-[2-(2-methylpyrazol-3-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 103015106 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 4-chloro-1-[2-(2-methylpyrazol-3-yl)ethyl]piperidine |
| SMILES | Cn1nccc1CCN1CCC(Cl)CC1 |
| InChI | InChI=1S/C11H18ClN3/c1-14-11(2-6-13-14)5-9-15-7-3-10(12)4-8-15/h2,6,10H,3-5,7-9H2,1H3 |
| InChIKey | JKIGBVXHQTUVQE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|