C11H20N4 — CID 102999239
1-[2-(2-methylpyrazol-3-yl)ethyl]piperidin-3-amine (PubChem CID 102999239) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 1-[2-(2-methylpyrazol-3-yl)ethyl]piperidin-3-amine.
| Compound Name | 1-[2-(2-methylpyrazol-3-yl)ethyl]piperidin-3-amine |
|---|---|
| PubChem CID | 102999239 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 1-[2-(2-methylpyrazol-3-yl)ethyl]piperidin-3-amine |
| SMILES | Cn1nccc1CCN1CCCC(N)C1 |
| InChI | InChI=1S/C11H20N4/c1-14-11(4-6-13-14)5-8-15-7-2-3-10(12)9-15/h4,6,10H,2-3,5,7-9,12H2,1H3 |
| InChIKey | RLVWABDMRDKEDY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |