C9H13N3O3S — CID 104709956
1-(2-methylpyrazol-3-yl)sulfonylpiperidin-4-one (PubChem CID 104709956) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is 1-(2-methylpyrazol-3-yl)sulfonylpiperidin-4-one.
| Compound Name | 1-(2-methylpyrazol-3-yl)sulfonylpiperidin-4-one |
|---|---|
| PubChem CID | 104709956 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 1-(2-methylpyrazol-3-yl)sulfonylpiperidin-4-one |
| SMILES | Cn1nccc1S(=O)(=O)N1CCC(=O)CC1 |
| InChI | InChI=1S/C9H13N3O3S/c1-11-9(2-5-10-11)16(14,15)12-6-3-8(13)4-7-12/h2,5H,3-4,6-7H2,1H3 |
| InChIKey | UOUHYFAIYWVJCA-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |