C11H17N3O4S — CID 113444014
methyl 1-(2-methylpyrazol-3-yl)sulfonylpiperidine-4-carboxylate (PubChem CID 113444014) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is methyl 1-(2-methylpyrazol-3-yl)sulfonylpiperidine-4-carboxylate.
| Compound Name | methyl 1-(2-methylpyrazol-3-yl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 113444014 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | methyl 1-(2-methylpyrazol-3-yl)sulfonylpiperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(S(=O)(=O)c2ccnn2C)CC1 |
| InChI | InChI=1S/C11H17N3O4S/c1-13-10(3-6-12-13)19(16,17)14-7-4-9(5-8-14)11(15)18-2/h3,6,9H,4-5,7-8H2,1-2H3 |
| InChIKey | JGQFNAUXAODROI-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |