C15H18FNO3S — CID 79539689
2-[1-(2-fluorophenyl)sulfonylpyrrolidin-2-yl]cyclopentan-1-one (PubChem CID 79539689) has the molecular formula C15H18FNO3S and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-[1-(2-fluorophenyl)sulfonylpyrrolidin-2-yl]cyclopentan-1-one.
| Compound Name | 2-[1-(2-fluorophenyl)sulfonylpyrrolidin-2-yl]cyclopentan-1-one |
|---|---|
| PubChem CID | 79539689 |
| Molecular Formula | C15H18FNO3S |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-[1-(2-fluorophenyl)sulfonylpyrrolidin-2-yl]cyclopentan-1-one |
| SMILES | O=C1CCCC1C1CCCN1S(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C15H18FNO3S/c16-12-6-1-2-9-15(12)21(19,20)17-10-4-7-13(17)11-5-3-8-14(11)18/h1-2,6,9,11,13H,3-5,7-8,10H2 |
| InChIKey | UIDLDTIOOYRQGN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |