C16H19BrClNO3S — CID 97319363
(2S)-2-[(2R)-1-(4-bromo-2-chlorophenyl)sulfonylpyrrolidin-2-yl]cyclohexan-1-one (PubChem CID 97319363) has the molecular formula C16H19BrClNO3S and a molecular weight of 420.76 g/mol. Its IUPAC name is (2S)-2-[(2R)-1-(4-bromo-2-chlorophenyl)sulfonylpyrrolidin-2-yl]cyclohexan-1-one.
| Compound Name | (2S)-2-[(2R)-1-(4-bromo-2-chlorophenyl)sulfonylpyrrolidin-2-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 97319363 |
| Molecular Formula | C16H19BrClNO3S |
| Molecular Weight | 420.76 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | (2S)-2-[(2R)-1-(4-bromo-2-chlorophenyl)sulfonylpyrrolidin-2-yl]cyclohexan-1-one |
| SMILES | O=C1CCCC[C@H]1[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C16H19BrClNO3S/c17-11-7-8-16(13(18)10-11)23(21,22)19-9-3-5-14(19)12-4-1-2-6-15(12)20/h7-8,10,12,14H,1-6,9H2/t12-,14+/m0/s1 |
| InChIKey | VOCPTVXGWYEZFU-GXTWGEPZSA-N |
| XLogP | 4.01 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.76 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |