C13H19BrCl2N2O2S — CID 119984801
[1-(4-bromo-2-chlorophenyl)sulfonyl-3-methylpiperidin-2-yl]methanamine;hydrochloride (PubChem CID 119984801) has the molecular formula C13H19BrCl2N2O2S and a molecular weight of 418.18 g/mol. Its IUPAC name is [1-(4-bromo-2-chlorophenyl)sulfonyl-3-methylpiperidin-2-yl]methanamine;hydrochloride.
| Compound Name | [1-(4-bromo-2-chlorophenyl)sulfonyl-3-methylpiperidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119984801 |
| Molecular Formula | C13H19BrCl2N2O2S |
| Molecular Weight | 418.18 g/mol |
| Exact Mass | 415.97 |
| IUPAC Name | [1-(4-bromo-2-chlorophenyl)sulfonyl-3-methylpiperidin-2-yl]methanamine;hydrochloride |
| SMILES | CC1CCCN(S(=O)(=O)c2ccc(Br)cc2Cl)C1CN.Cl |
| InChI | InChI=1S/C13H18BrClN2O2S.ClH/c1-9-3-2-6-17(12(9)8-16)20(18,19)13-5-4-10(14)7-11(13)15;/h4-5,7,9,12H,2-3,6,8,16H2,1H3;1H |
| InChIKey | HRKJNBGTLJJWBG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.18 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |