C13H22ClN3O4S2 — CID 119984868
3-[2-(aminomethyl)-3-methylpiperidin-1-yl]sulfonylbenzenesulfonamide;hydrochloride (PubChem CID 119984868) has the molecular formula C13H22ClN3O4S2 and a molecular weight of 383.92 g/mol. Its IUPAC name is 3-[2-(aminomethyl)-3-methylpiperidin-1-yl]sulfonylbenzenesulfonamide;hydrochloride.
| Compound Name | 3-[2-(aminomethyl)-3-methylpiperidin-1-yl]sulfonylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119984868 |
| Molecular Formula | C13H22ClN3O4S2 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 3-[2-(aminomethyl)-3-methylpiperidin-1-yl]sulfonylbenzenesulfonamide;hydrochloride |
| SMILES | CC1CCCN(S(=O)(=O)c2cccc(S(N)(=O)=O)c2)C1CN.Cl |
| InChI | InChI=1S/C13H21N3O4S2.ClH/c1-10-4-3-7-16(13(10)9-14)22(19,20)12-6-2-5-11(8-12)21(15,17)18;/h2,5-6,8,10,13H,3-4,7,9,14H2,1H3,(H2,15,17,18);1H |
| InChIKey | YTQUVFKAKOMLPV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |