C12H20ClN3O4S2 — CID 120582098
3-[4-(aminomethyl)-2-methylpyrrolidin-1-yl]sulfonylbenzenesulfonamide;hydrochloride (PubChem CID 120582098) has the molecular formula C12H20ClN3O4S2 and a molecular weight of 369.90 g/mol. Its IUPAC name is 3-[4-(aminomethyl)-2-methylpyrrolidin-1-yl]sulfonylbenzenesulfonamide;hydrochloride.
| Compound Name | 3-[4-(aminomethyl)-2-methylpyrrolidin-1-yl]sulfonylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120582098 |
| Molecular Formula | C12H20ClN3O4S2 |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 3-[4-(aminomethyl)-2-methylpyrrolidin-1-yl]sulfonylbenzenesulfonamide;hydrochloride |
| SMILES | CC1CC(CN)CN1S(=O)(=O)c1cccc(S(N)(=O)=O)c1.Cl |
| InChI | InChI=1S/C12H19N3O4S2.ClH/c1-9-5-10(7-13)8-15(9)21(18,19)12-4-2-3-11(6-12)20(14,16)17;/h2-4,6,9-10H,5,7-8,13H2,1H3,(H2,14,16,17);1H |
| InChIKey | MRRFYIIOTBZNMI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |