C15H19ClN2O4S — CID 120582052
6-[4-(aminomethyl)-2-methylpyrrolidin-1-yl]sulfonylchromen-2-one;hydrochloride (PubChem CID 120582052) has the molecular formula C15H19ClN2O4S and a molecular weight of 358.85 g/mol. Its IUPAC name is 6-[4-(aminomethyl)-2-methylpyrrolidin-1-yl]sulfonylchromen-2-one;hydrochloride.
| Compound Name | 6-[4-(aminomethyl)-2-methylpyrrolidin-1-yl]sulfonylchromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 120582052 |
| Molecular Formula | C15H19ClN2O4S |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 6-[4-(aminomethyl)-2-methylpyrrolidin-1-yl]sulfonylchromen-2-one;hydrochloride |
| SMILES | CC1CC(CN)CN1S(=O)(=O)c1ccc2oc(=O)ccc2c1.Cl |
| InChI | InChI=1S/C15H18N2O4S.ClH/c1-10-6-11(8-16)9-17(10)22(19,20)13-3-4-14-12(7-13)2-5-15(18)21-14;/h2-5,7,10-11H,6,8-9,16H2,1H3;1H |
| InChIKey | TYOUGZQHVGVINK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|