C13H21ClN2O4S2 — CID 120582130
[5-methyl-1-(4-methylsulfonylphenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120582130) has the molecular formula C13H21ClN2O4S2 and a molecular weight of 368.91 g/mol. Its IUPAC name is [5-methyl-1-(4-methylsulfonylphenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [5-methyl-1-(4-methylsulfonylphenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120582130 |
| Molecular Formula | C13H21ClN2O4S2 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | [5-methyl-1-(4-methylsulfonylphenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | CC1CC(CN)CN1S(=O)(=O)c1ccc(S(C)(=O)=O)cc1.Cl |
| InChI | InChI=1S/C13H20N2O4S2.ClH/c1-10-7-11(8-14)9-15(10)21(18,19)13-5-3-12(4-6-13)20(2,16)17;/h3-6,10-11H,7-9,14H2,1-2H3;1H |
| InChIKey | WHLPAYVFEMFNCF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |