C15H18BrClN2O4S — CID 47017134
[1-(4-bromo-2-chlorophenyl)sulfonylpyrrolidin-2-yl]-morpholin-4-ylmethanone (PubChem CID 47017134) has the molecular formula C15H18BrClN2O4S and a molecular weight of 437.74 g/mol. Its IUPAC name is [1-(4-bromo-2-chlorophenyl)sulfonylpyrrolidin-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-(4-bromo-2-chlorophenyl)sulfonylpyrrolidin-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 47017134 |
| Molecular Formula | C15H18BrClN2O4S |
| Molecular Weight | 437.74 g/mol |
| Exact Mass | 435.99 |
| IUPAC Name | [1-(4-bromo-2-chlorophenyl)sulfonylpyrrolidin-2-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(C1CCCN1S(=O)(=O)c1ccc(Br)cc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C15H18BrClN2O4S/c16-11-3-4-14(12(17)10-11)24(21,22)19-5-1-2-13(19)15(20)18-6-8-23-9-7-18/h3-4,10,13H,1-2,5-9H2 |
| InChIKey | HKEVKTCDVNPHLB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.74 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |