C16H21BrN2O5S — CID 55601195
[1-(3-bromo-4-methoxyphenyl)sulfonylpyrrolidin-2-yl]-morpholin-4-ylmethanone (PubChem CID 55601195) has the molecular formula C16H21BrN2O5S and a molecular weight of 433.32 g/mol. Its IUPAC name is [1-(3-bromo-4-methoxyphenyl)sulfonylpyrrolidin-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-(3-bromo-4-methoxyphenyl)sulfonylpyrrolidin-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 55601195 |
| Molecular Formula | C16H21BrN2O5S |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | [1-(3-bromo-4-methoxyphenyl)sulfonylpyrrolidin-2-yl]-morpholin-4-ylmethanone |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2C(=O)N2CCOCC2)cc1Br |
| InChI | InChI=1S/C16H21BrN2O5S/c1-23-15-5-4-12(11-13(15)17)25(21,22)19-6-2-3-14(19)16(20)18-7-9-24-10-8-18/h4-5,11,14H,2-3,6-10H2,1H3 |
| InChIKey | TYWOBGKYAQDQML-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |