C16H22BrN3O5S — CID 24603024
[4-(3-bromo-4-methoxyphenyl)sulfonylpiperazin-1-yl]-morpholin-4-ylmethanone (PubChem CID 24603024) has the molecular formula C16H22BrN3O5S and a molecular weight of 448.34 g/mol. Its IUPAC name is [4-(3-bromo-4-methoxyphenyl)sulfonylpiperazin-1-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-(3-bromo-4-methoxyphenyl)sulfonylpiperazin-1-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 24603024 |
| Molecular Formula | C16H22BrN3O5S |
| Molecular Weight | 448.34 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | [4-(3-bromo-4-methoxyphenyl)sulfonylpiperazin-1-yl]-morpholin-4-ylmethanone |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)N3CCOCC3)CC2)cc1Br |
| InChI | InChI=1S/C16H22BrN3O5S/c1-24-15-3-2-13(12-14(15)17)26(22,23)20-6-4-18(5-7-20)16(21)19-8-10-25-11-9-19/h2-3,12H,4-11H2,1H3 |
| InChIKey | IIRSSHOYQBOPRD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |