C22H34NP — CID 163198375
(1R,2S)-N,N-dicyclohexyl-1-phenylphospholan-2-amine (PubChem CID 163198375) has the molecular formula C22H34NP and a molecular weight of 343.49 g/mol. Its IUPAC name is (1R,2S)-N,N-dicyclohexyl-1-phenylphospholan-2-amine.
| Compound Name | (1R,2S)-N,N-dicyclohexyl-1-phenylphospholan-2-amine |
|---|---|
| PubChem CID | 163198375 |
| Molecular Formula | C22H34NP |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | (1R,2S)-N,N-dicyclohexyl-1-phenylphospholan-2-amine |
| SMILES | c1ccc([P@@]2CCC[C@H]2N(C2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H34NP/c1-4-11-19(12-5-1)23(20-13-6-2-7-14-20)22-17-10-18-24(22)21-15-8-3-9-16-21/h3,8-9,15-16,19-20,22H,1-2,4-7,10-14,17-18H2/t22-,24+/m0/s1 |
| InChIKey | SETKOIBVPCXJGB-LADGPHEKSA-N |
| XLogP | 5.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|