C19H24NP — CID 155898598
(1S)-N-(3,5-dimethylphenyl)-1-phenylphosphinan-2-amine (PubChem CID 155898598) has the molecular formula C19H24NP and a molecular weight of 297.38 g/mol. Its IUPAC name is (1S)-N-(3,5-dimethylphenyl)-1-phenylphosphinan-2-amine.
| Compound Name | (1S)-N-(3,5-dimethylphenyl)-1-phenylphosphinan-2-amine |
|---|---|
| PubChem CID | 155898598 |
| Molecular Formula | C19H24NP |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (1S)-N-(3,5-dimethylphenyl)-1-phenylphosphinan-2-amine |
| SMILES | Cc1cc(C)cc(NC2CCCC[P@@]2c2ccccc2)c1 |
| InChI | InChI=1S/C19H24NP/c1-15-12-16(2)14-17(13-15)20-19-10-6-7-11-21(19)18-8-4-3-5-9-18/h3-5,8-9,12-14,19-20H,6-7,10-11H2,1-2H3/t19?,21-/m0/s1 |
| InChIKey | URJKUDFKPXUDDL-QWAKEFERSA-N |
| XLogP | 5.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|