About 2-phenyl-6-oxa-2λ5-phosphabicyclo[3.1.0]hexane 2-oxide
2-phenyl-6-oxa-2λ5-phosphabicyclo[3.1.0]hexane 2-oxide (PubChem CID 102257098) has the molecular formula C10H11O2P
and a molecular weight of 194.17 g/mol. Its IUPAC name is 2-phenyl-6-oxa-2λ5-phosphabicyclo[3.1.0]hexane 2-oxide.
Molecular Properties
| Compound Name | 2-phenyl-6-oxa-2λ5-phosphabicyclo[3.1.0]hexane 2-oxide |
| PubChem CID | 102257098 |
| Molecular Formula | C10H11O2P |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 2-phenyl-6-oxa-2λ5-phosphabicyclo[3.1.0]hexane 2-oxide |
| SMILES | O=P1(c2ccccc2)CCC2OC21 |
| InChI | InChI=1S/C10H11O2P/c11-13(7-6-9-10(13)12-9)8-4-2-1-3-5-8/h1-5,9-10H,6-7H2 |
| InChIKey | CUZLKQIXYIUJBJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-6-oxa-2λ5-phosphabicyclo[3.1.0]hexane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-6-oxa-2λ5-phosphabicyclo[3.1.0]hexane 2-oxide?
The IUPAC name of 2-phenyl-6-oxa-2λ5-phosphabicyclo[3.1.0]hexane 2-oxide (CID 102257098) is 2-phenyl-6-oxa-2λ5-phosphabicyclo[3.1.0]hexane 2-oxide.
What is the SMILES notation for 2-phenyl-6-oxa-2λ5-phosphabicyclo[3.1.0]hexane 2-oxide?
The canonical SMILES for 2-phenyl-6-oxa-2λ5-phosphabicyclo[3.1.0]hexane 2-oxide is O=P1(c2ccccc2)CCC2OC21.
What is the InChIKey of 2-phenyl-6-oxa-2λ5-phosphabicyclo[3.1.0]hexane 2-oxide?
The InChIKey is CUZLKQIXYIUJBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11O2P/c11-13(7-6-9-10(13)12-9)8-4-2-1-3-5-8/h1-5,9-10H,6-7H2.
What are the key properties of 2-phenyl-6-oxa-2λ5-phosphabicyclo[3.1.0]hexane 2-oxide?
2-phenyl-6-oxa-2λ5-phosphabicyclo[3.1.0]hexane 2-oxide has a molecular weight of 194.17 g/mol, XLogP of 1.80, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-6-oxa-2λ5-phosphabicyclo[3.1.0]hexane 2-oxide is sourced from PubChem (CID 102257098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).