C39H55O2P2+ — CID 154081538
[bis(3,5-ditert-butylphenyl)-(1-oxo-1-phenyl-1λ5-phospholan-2-yl)methyl]-oxophosphanium (PubChem CID 154081538) has the molecular formula C39H55O2P2+ and a molecular weight of 617.82 g/mol. Its IUPAC name is [bis(3,5-ditert-butylphenyl)-(1-oxo-1-phenyl-1λ5-phospholan-2-yl)methyl]-oxophosphanium.
| Compound Name | [bis(3,5-ditert-butylphenyl)-(1-oxo-1-phenyl-1λ5-phospholan-2-yl)methyl]-oxophosphanium |
|---|---|
| PubChem CID | 154081538 |
| Molecular Formula | C39H55O2P2+ |
| Molecular Weight | 617.82 g/mol |
| Exact Mass | 617.37 |
| IUPAC Name | [bis(3,5-ditert-butylphenyl)-(1-oxo-1-phenyl-1λ5-phospholan-2-yl)methyl]-oxophosphanium |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)cc(C([PH+]=O)(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)C2CCCP2(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C39H54O2P2/c1-35(2,3)27-21-28(36(4,5)6)24-31(23-27)39(42-40,34-19-16-20-43(34,41)33-17-14-13-15-18-33)32-25-29(37(7,8)9)22-30(26-32)38(10,11)12/h13-15,17-18,21-26,34H,16,19-20H2,1-12H3/p+1 |
| InChIKey | HJUASOZQMVWUMG-UHFFFAOYSA-O |
| XLogP | 11.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.82 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|