C24H26BOP2+ — CID 89107891
CID 89107891 (PubChem CID 89107891) has the molecular formula C24H26BOP2+ and a molecular weight of 403.23 g/mol.
| Compound Name | CID 89107891 |
|---|---|
| PubChem CID | 89107891 |
| Molecular Formula | C24H26BOP2+ |
| Molecular Weight | 403.23 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | — |
| SMILES | [B][P+](CC[C@H]1CCC[P@]1(=O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26BOP2/c25-27(21-11-4-1-5-12-21,22-13-6-2-7-14-22)20-18-24-17-10-19-28(24,26)23-15-8-3-9-16-23/h1-9,11-16,24H,10,17-20H2/q+1/t24-,28+/m1/s1 |
| InChIKey | AEQZZKUNCDEOIG-YWEHKCAJSA-N |
| XLogP | 4.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.23 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|