C28H33OP — CID 14897930
(3aR,4aS,6S)-6-tert-butyl-8-diphenylphosphoryl-1,2,3,3a,4,4a,5,6-octahydro-s-indacene (PubChem CID 14897930) has the molecular formula C28H33OP and a molecular weight of 416.55 g/mol. Its IUPAC name is (3aR,4aS,6S)-6-tert-butyl-8-diphenylphosphoryl-1,2,3,3a,4,4a,5,6-octahydro-s-indacene.
| Compound Name | (3aR,4aS,6S)-6-tert-butyl-8-diphenylphosphoryl-1,2,3,3a,4,4a,5,6-octahydro-s-indacene |
|---|---|
| PubChem CID | 14897930 |
| Molecular Formula | C28H33OP |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | (3aR,4aS,6S)-6-tert-butyl-8-diphenylphosphoryl-1,2,3,3a,4,4a,5,6-octahydro-s-indacene |
| SMILES | CC(C)(C)[C@@H]1C=C2C(P(=O)(c3ccccc3)c3ccccc3)=C3CCC[C@@H]3C[C@H]2C1 |
| InChI | InChI=1S/C28H33OP/c1-28(2,3)22-18-21-17-20-11-10-16-25(20)27(26(21)19-22)30(29,23-12-6-4-7-13-23)24-14-8-5-9-15-24/h4-9,12-15,19-22H,10-11,16-18H2,1-3H3/t20-,21+,22+/m1/s1 |
| InChIKey | QWLXZHPJOOEZNQ-FSSWDIPSSA-N |
| XLogP | 7.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|