C16H19NO — CID 10490303
N-[(2S,6aR)-3-phenyl-1,2,4,5,6,6a-hexahydropentalen-2-yl]acetamide (PubChem CID 10490303) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is N-[(2S,6aR)-3-phenyl-1,2,4,5,6,6a-hexahydropentalen-2-yl]acetamide.
| Compound Name | N-[(2S,6aR)-3-phenyl-1,2,4,5,6,6a-hexahydropentalen-2-yl]acetamide |
|---|---|
| PubChem CID | 10490303 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | N-[(2S,6aR)-3-phenyl-1,2,4,5,6,6a-hexahydropentalen-2-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C[C@H]2CCCC2=C1c1ccccc1 |
| InChI | InChI=1S/C16H19NO/c1-11(18)17-15-10-13-8-5-9-14(13)16(15)12-6-3-2-4-7-12/h2-4,6-7,13,15H,5,8-10H2,1H3,(H,17,18)/t13-,15+/m1/s1 |
| InChIKey | TXTUEZRSEDJYOQ-HIFRSBDPSA-N |
| XLogP | 3.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |