C23H25N2OP — CID 3058098
1,3-dibenzyl-5-phenyl-1,3,5lambda5-diazaphosphinane 5-oxide (PubChem CID 3058098) has the molecular formula C23H25N2OP and a molecular weight of 376.44 g/mol. Its IUPAC name is 1,3-dibenzyl-5-phenyl-1,3,5lambda5-diazaphosphinane 5-oxide.
| Compound Name | 1,3-dibenzyl-5-phenyl-1,3,5lambda5-diazaphosphinane 5-oxide |
|---|---|
| PubChem CID | 3058098 |
| Molecular Formula | C23H25N2OP |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1,3-dibenzyl-5-phenyl-1,3,5lambda5-diazaphosphinane 5-oxide |
| SMILES | O=P1(c2ccccc2)CN(Cc2ccccc2)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H25N2OP/c26-27(23-14-8-3-9-15-23)19-24(16-21-10-4-1-5-11-21)18-25(20-27)17-22-12-6-2-7-13-22/h1-15H,16-20H2 |
| InChIKey | CPTTVZPDNYTFSJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|