C11H16NO2P — CID 126640116
1-benzyl-4-hydroxy-1,4λ5-azaphosphinane 4-oxide (PubChem CID 126640116) has the molecular formula C11H16NO2P and a molecular weight of 225.23 g/mol. Its IUPAC name is 1-benzyl-4-hydroxy-1,4λ5-azaphosphinane 4-oxide.
| Compound Name | 1-benzyl-4-hydroxy-1,4λ5-azaphosphinane 4-oxide |
|---|---|
| PubChem CID | 126640116 |
| Molecular Formula | C11H16NO2P |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 1-benzyl-4-hydroxy-1,4λ5-azaphosphinane 4-oxide |
| SMILES | O=P1(O)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C11H16NO2P/c13-15(14)8-6-12(7-9-15)10-11-4-2-1-3-5-11/h1-5H,6-10H2,(H,13,14) |
| InChIKey | VTDYHDZZFLEFLG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|