C17H19BrNOP — CID 169108614
1-benzyl-4-(4-bromophenyl)-1,4λ5-azaphosphinane 4-oxide (PubChem CID 169108614) has the molecular formula C17H19BrNOP and a molecular weight of 364.22 g/mol. Its IUPAC name is 1-benzyl-4-(4-bromophenyl)-1,4λ5-azaphosphinane 4-oxide.
| Compound Name | 1-benzyl-4-(4-bromophenyl)-1,4λ5-azaphosphinane 4-oxide |
|---|---|
| PubChem CID | 169108614 |
| Molecular Formula | C17H19BrNOP |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 1-benzyl-4-(4-bromophenyl)-1,4λ5-azaphosphinane 4-oxide |
| SMILES | O=P1(c2ccc(Br)cc2)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C17H19BrNOP/c18-16-6-8-17(9-7-16)21(20)12-10-19(11-13-21)14-15-4-2-1-3-5-15/h1-9H,10-14H2 |
| InChIKey | QRQLVVWUFHTJMK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|