C25H32BrN3O4 — CID 17366692
1-(1-benzylpiperidin-4-yl)-4-[(4-bromophenyl)methyl]piperazine;oxalic acid (PubChem CID 17366692) has the molecular formula C25H32BrN3O4 and a molecular weight of 518.45 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-4-[(4-bromophenyl)methyl]piperazine;oxalic acid.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-4-[(4-bromophenyl)methyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 17366692 |
| Molecular Formula | C25H32BrN3O4 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-4-[(4-bromophenyl)methyl]piperazine;oxalic acid |
| SMILES | Brc1ccc(CN2CCN(C3CCN(Cc4ccccc4)CC3)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H30BrN3.C2H2O4/c24-22-8-6-21(7-9-22)19-26-14-16-27(17-15-26)23-10-12-25(13-11-23)18-20-4-2-1-3-5-20;3-1(4)2(5)6/h1-9,23H,10-19H2;(H,3,4)(H,5,6) |
| InChIKey | BOAFSIUASHKUAU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|