C23H35N3O5 — CID 17369370
4-[1-(1-benzylpiperidin-4-yl)piperidin-4-yl]morpholine;oxalic acid (PubChem CID 17369370) has the molecular formula C23H35N3O5 and a molecular weight of 433.55 g/mol. Its IUPAC name is 4-[1-(1-benzylpiperidin-4-yl)piperidin-4-yl]morpholine;oxalic acid.
| Compound Name | 4-[1-(1-benzylpiperidin-4-yl)piperidin-4-yl]morpholine;oxalic acid |
|---|---|
| PubChem CID | 17369370 |
| Molecular Formula | C23H35N3O5 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 4-[1-(1-benzylpiperidin-4-yl)piperidin-4-yl]morpholine;oxalic acid |
| SMILES | O=C(O)C(=O)O.c1ccc(CN2CCC(N3CCC(N4CCOCC4)CC3)CC2)cc1 |
| InChI | InChI=1S/C21H33N3O.C2H2O4/c1-2-4-19(5-3-1)18-22-10-6-20(7-11-22)23-12-8-21(9-13-23)24-14-16-25-17-15-24;3-1(4)2(5)6/h1-5,20-21H,6-18H2;(H,3,4)(H,5,6) |
| InChIKey | HFUCKURECPQJGV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|