C14H22NOP — CID 67432951
1-benzyl-4-propan-2-yl-1,4λ5-azaphosphinane 4-oxide (PubChem CID 67432951) has the molecular formula C14H22NOP and a molecular weight of 251.31 g/mol. Its IUPAC name is 1-benzyl-4-propan-2-yl-1,4λ5-azaphosphinane 4-oxide.
| Compound Name | 1-benzyl-4-propan-2-yl-1,4λ5-azaphosphinane 4-oxide |
|---|---|
| PubChem CID | 67432951 |
| Molecular Formula | C14H22NOP |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 1-benzyl-4-propan-2-yl-1,4λ5-azaphosphinane 4-oxide |
| SMILES | CC(C)P1(=O)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C14H22NOP/c1-13(2)17(16)10-8-15(9-11-17)12-14-6-4-3-5-7-14/h3-7,13H,8-12H2,1-2H3 |
| InChIKey | HVFYDEMWIYPLFB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|