C9H12N2 — CID 67702530
1-benzyl-1,3-diazetidine (PubChem CID 67702530) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 1-benzyl-1,3-diazetidine.
| Compound Name | 1-benzyl-1,3-diazetidine |
|---|---|
| PubChem CID | 67702530 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 1-benzyl-1,3-diazetidine |
| SMILES | c1ccc(CN2CNC2)cc1 |
| InChI | InChI=1S/C9H12N2/c1-2-4-9(5-3-1)6-11-7-10-8-11/h1-5,10H,6-8H2 |
| InChIKey | HHCUSQGDHKNBGX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |