C11H17N3 — CID 126970923
1-(2-phenylethyl)-1,3,5-triazinane (PubChem CID 126970923) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 1-(2-phenylethyl)-1,3,5-triazinane.
| Compound Name | 1-(2-phenylethyl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 126970923 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 1-(2-phenylethyl)-1,3,5-triazinane |
| SMILES | c1ccc(CCN2CNCNC2)cc1 |
| InChI | InChI=1S/C11H17N3/c1-2-4-11(5-3-1)6-7-14-9-12-8-13-10-14/h1-5,12-13H,6-10H2 |
| InChIKey | VPUOULBSRRXQKP-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |