C19H34N2 — CID 144963091
(3aR,6aS)-5-(2-phenylethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;ethane;propane (PubChem CID 144963091) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is (3aR,6aS)-5-(2-phenylethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;ethane;propane.
| Compound Name | (3aR,6aS)-5-(2-phenylethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;ethane;propane |
|---|---|
| PubChem CID | 144963091 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | (3aR,6aS)-5-(2-phenylethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;ethane;propane |
| SMILES | CC.CCC.c1ccc(CCN2C[C@H]3CNC[C@H]3C2)cc1 |
| InChI | InChI=1S/C14H20N2.C3H8.C2H6/c1-2-4-12(5-3-1)6-7-16-10-13-8-15-9-14(13)11-16;1-3-2;1-2/h1-5,13-15H,6-11H2;3H2,1-2H3;1-2H3/t13-,14+;; |
| InChIKey | NAEYXEZOAPXEMP-DUFSSLHGSA-N |
| XLogP | 3.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |