C19H29N3 — CID 121497137
(3aS,6aS)-1-[1-(2-phenylethyl)piperidin-4-yl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole (PubChem CID 121497137) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is (3aS,6aS)-1-[1-(2-phenylethyl)piperidin-4-yl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole.
| Compound Name | (3aS,6aS)-1-[1-(2-phenylethyl)piperidin-4-yl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole |
|---|---|
| PubChem CID | 121497137 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | (3aS,6aS)-1-[1-(2-phenylethyl)piperidin-4-yl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole |
| SMILES | c1ccc(CCN2CCC(N3CC[C@H]4CNC[C@H]43)CC2)cc1 |
| InChI | InChI=1S/C19H29N3/c1-2-4-16(5-3-1)6-10-21-11-8-18(9-12-21)22-13-7-17-14-20-15-19(17)22/h1-5,17-20H,6-15H2/t17-,19+/m0/s1 |
| InChIKey | ZJNVXKXWIQPANJ-PKOBYXMFSA-N |
| XLogP | 1.99 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |