C18H25N3O — CID 121496541
[4-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrol-1-yl]piperidin-1-yl]-phenylmethanone (PubChem CID 121496541) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is [4-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrol-1-yl]piperidin-1-yl]-phenylmethanone.
| Compound Name | [4-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrol-1-yl]piperidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 121496541 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | [4-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrol-1-yl]piperidin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCC(N2CC[C@H]3CNC[C@H]32)CC1 |
| InChI | InChI=1S/C18H25N3O/c22-18(14-4-2-1-3-5-14)20-9-7-16(8-10-20)21-11-6-15-12-19-13-17(15)21/h1-5,15-17,19H,6-13H2/t15-,17+/m0/s1 |
| InChIKey | USAUIIJRELVPNA-DOTOQJQBSA-N |
| XLogP | 1.58 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |