C18H27N3 — CID 130975158
(4aR,7aR)-1-(1-benzylpyrrolidin-3-yl)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 130975158) has the molecular formula C18H27N3 and a molecular weight of 285.43 g/mol. Its IUPAC name is (4aR,7aR)-1-(1-benzylpyrrolidin-3-yl)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | (4aR,7aR)-1-(1-benzylpyrrolidin-3-yl)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 130975158 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | (4aR,7aR)-1-(1-benzylpyrrolidin-3-yl)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | c1ccc(CN2CCC(N3CCC[C@@H]4CNC[C@@H]43)C2)cc1 |
| InChI | InChI=1S/C18H27N3/c1-2-5-15(6-3-1)13-20-10-8-17(14-20)21-9-4-7-16-11-19-12-18(16)21/h1-3,5-6,16-19H,4,7-14H2/t16-,17?,18+/m1/s1 |
| InChIKey | SVVNMYGZHPUUCP-BLAYRMRBSA-N |
| XLogP | 1.94 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |