C23H24P+ — CID 98533107
(4S)-4,7-dimethyl-2,2-diphenyl-3,4-dihydro-1H-isophosphinolin-2-ium (PubChem CID 98533107) has the molecular formula C23H24P+ and a molecular weight of 331.42 g/mol. Its IUPAC name is (4S)-4,7-dimethyl-2,2-diphenyl-3,4-dihydro-1H-isophosphinolin-2-ium.
| Compound Name | (4S)-4,7-dimethyl-2,2-diphenyl-3,4-dihydro-1H-isophosphinolin-2-ium |
|---|---|
| PubChem CID | 98533107 |
| Molecular Formula | C23H24P+ |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (4S)-4,7-dimethyl-2,2-diphenyl-3,4-dihydro-1H-isophosphinolin-2-ium |
| SMILES | Cc1ccc2c(c1)C[P+](c1ccccc1)(c1ccccc1)C[C@H]2C |
| InChI | InChI=1S/C23H24P/c1-18-13-14-23-19(2)16-24(17-20(23)15-18,21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-15,19H,16-17H2,1-2H3/q+1/t19-/m1/s1 |
| InChIKey | RUGCBCBHQGLVKZ-LJQANCHMSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|