C18H20P+ — CID 10935558
3,4-dimethyl-1,1-diphenyl-2,5-dihydrophosphol-1-ium (PubChem CID 10935558) has the molecular formula C18H20P+ and a molecular weight of 267.33 g/mol. Its IUPAC name is 3,4-dimethyl-1,1-diphenyl-2,5-dihydrophosphol-1-ium.
| Compound Name | 3,4-dimethyl-1,1-diphenyl-2,5-dihydrophosphol-1-ium |
|---|---|
| PubChem CID | 10935558 |
| Molecular Formula | C18H20P+ |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3,4-dimethyl-1,1-diphenyl-2,5-dihydrophosphol-1-ium |
| SMILES | CC1=C(C)C[P+](c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C18H20P/c1-15-13-19(14-16(15)2,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12H,13-14H2,1-2H3/q+1 |
| InChIKey | RYBZPOJYIGSTDO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|