C11H13ClP+ — CID 23279875
1-chloro-4-methyl-1-phenyl-2,3-dihydrophosphol-1-ium (PubChem CID 23279875) has the molecular formula C11H13ClP+ and a molecular weight of 211.65 g/mol. Its IUPAC name is 1-chloro-4-methyl-1-phenyl-2,3-dihydrophosphol-1-ium.
| Compound Name | 1-chloro-4-methyl-1-phenyl-2,3-dihydrophosphol-1-ium |
|---|---|
| PubChem CID | 23279875 |
| Molecular Formula | C11H13ClP+ |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 1-chloro-4-methyl-1-phenyl-2,3-dihydrophosphol-1-ium |
| SMILES | CC1=C[P+](Cl)(c2ccccc2)CC1 |
| InChI | InChI=1S/C11H13ClP/c1-10-7-8-13(12,9-10)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3/q+1 |
| InChIKey | WVUMURARPJRLAR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|