C27H26ClP3+2 — CID 23415328
2-(chloromethyl)-1,1,3,3-tetraphenyltriphospholane-1,3-diium (PubChem CID 23415328) has the molecular formula C27H26ClP3+2 and a molecular weight of 478.88 g/mol. Its IUPAC name is 2-(chloromethyl)-1,1,3,3-tetraphenyltriphospholane-1,3-diium.
| Compound Name | 2-(chloromethyl)-1,1,3,3-tetraphenyltriphospholane-1,3-diium |
|---|---|
| PubChem CID | 23415328 |
| Molecular Formula | C27H26ClP3+2 |
| Molecular Weight | 478.88 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 2-(chloromethyl)-1,1,3,3-tetraphenyltriphospholane-1,3-diium |
| SMILES | ClCP1[P+](c2ccccc2)(c2ccccc2)CC[P+]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26ClP3/c28-23-29-30(24-13-5-1-6-14-24,25-15-7-2-8-16-25)21-22-31(29,26-17-9-3-10-18-26)27-19-11-4-12-20-27/h1-20H,21-23H2/q+2 |
| InChIKey | IEIKWXBMEYNXBB-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.88 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|