C29H31P3+2 — CID 23421390
2-methyl-1,1,3,3-tetraphenyltriphosphepane-1,3-diium (PubChem CID 23421390) has the molecular formula C29H31P3+2 and a molecular weight of 472.49 g/mol. Its IUPAC name is 2-methyl-1,1,3,3-tetraphenyltriphosphepane-1,3-diium.
| Compound Name | 2-methyl-1,1,3,3-tetraphenyltriphosphepane-1,3-diium |
|---|---|
| PubChem CID | 23421390 |
| Molecular Formula | C29H31P3+2 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 2-methyl-1,1,3,3-tetraphenyltriphosphepane-1,3-diium |
| SMILES | CP1[P+](c2ccccc2)(c2ccccc2)CCCC[P+]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H31P3/c1-30-31(26-16-6-2-7-17-26,27-18-8-3-9-19-27)24-14-15-25-32(30,28-20-10-4-11-21-28)29-22-12-5-13-23-29/h2-13,16-23H,14-15,24-25H2,1H3/q+2 |
| InChIKey | HUMACYFQVYMCHN-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|